7-fluoro-1H-indole-2-carboxylic acid
7-fluoro-1H-indole-2-carboxylic acid
CAS: 399-67-7
Molecular Formula: C9H6FNO2
7-fluoro-1H-indole-2-carboxylic acid - Names and Identifiers
| Name | 7-fluoro-1H-indole-2-carboxylic acid |
| Synonyms | 7-Fluoro-indole-2-carboxylic acid 7-Fluoro-1H-indole-2-carboxylicacid 7-FLUORO-1H-INDOLE-2-CARBOXYLIC ACID 7-fluoro-1H-indole-2-carboxylic acid 1H-Indole-2-carboxylic acid, 7-fluoro- 1H-indole-2-carboxylic acid, 7-fluoro- |
| CAS | 399-67-7 |
| EINECS | 201-215-5 |
| InChI | InChI=1/C9H6FNO2/c10-6-3-1-2-5-4-7(9(12)13)11-8(5)6/h1-4,11H,(H,12,13) |
7-fluoro-1H-indole-2-carboxylic acid - Physico-chemical Properties
| Molecular Formula | C9H6FNO2 |
| Molar Mass | 179.15 |
| Density | 1.510±0.06 g/cm3(Predicted) |
| Melting Point | 198 °C (decomp) |
| Boling Point | 422.2±25.0 °C(Predicted) |
| Flash Point | 209.116°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 4.25±0.30(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Sensitive | Irritant |
| Refractive Index | 1.692 |
| MDL | MFCD02664429 |
| Physical and Chemical Properties |
|
7-fluoro-1H-indole-2-carboxylic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | IRRITANT |
